CAS 497258-85-2 appears in our catalog under these names: 1–methyl–3–octyl–1H–imidazol–3–ium hydrogen sulfate, 3-Methyl-1-octyl-1H-imidazol-3-ium sulfate, 98%, 98%, 1-methyl-3-octyl-1H-imidazol-3-ium hydrogen sulfate, 98%, 3-Methyl-1-octyl-1H-imidazol-3-ium sulfate, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 1g, 5g, 10g, 100g, 500g.
Hydrogen sulfate;1-methyl-3-octylimidazol-1-ium (CAS 497258-85-2) is a chemical compound with the molecular formula C12H24N2O4S and a molecular weight of 292.40 g/mol. IUPAC name: hydrogen sulfate;1-methyl-3-octylimidazol-1-ium. InChIKey: RRABSTHQUPQUTI-UHFFFAOYSA-M.
| Molecular formula | C12H24N2O4S |
|---|---|
| Molecular weight | 292.40 g/mol |
| IUPAC name | hydrogen sulfate;1-methyl-3-octylimidazol-1-ium |
| InChIKey | RRABSTHQUPQUTI-UHFFFAOYSA-M |
| SMILES | CCCCCCCCN1C=C[N+](=C1)C.OS(=O)(=O)[O-] |
Computed by PubChem (NCBI)