Products 1423034-49-4
CAS 1423034-49-4 appears in our catalog under these names: 2-(Benzyloxy)-5-fluoroaniline hydrochloride, 95%, 2-(Benzyloxy)-5-fluoroaniline hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
5-fluoro-2-phenylmethoxyaniline;hydrochloride (CAS 1423034-49-4) is a chemical compound with the molecular formula C13H13ClFNO and a molecular weight of 253.70 g/mol. IUPAC name: 5-fluoro-2-phenylmethoxyaniline;hydrochloride. InChIKey: ZRSMWFYDPYYZGI-UHFFFAOYSA-N.
| Molecular formula | C13H13ClFNO |
|---|---|
| Molecular weight | 253.70 g/mol |
| IUPAC name | 5-fluoro-2-phenylmethoxyaniline;hydrochloride |
| InChIKey | ZRSMWFYDPYYZGI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)F)N.Cl |
Computed by PubChem (NCBI)