CAS 1002651-00-4 is the registry number for 1-(3,5-Dimethyl-4-nitro-1h-pyrazol-1-yl)acetone, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
1-(3,5-dimethyl-4-nitropyrazol-1-yl)propan-2-one (CAS 1002651-00-4) is a chemical compound with the molecular formula C8H11N3O3 and a molecular weight of 197.19 g/mol. IUPAC name: 1-(3,5-dimethyl-4-nitropyrazol-1-yl)propan-2-one. InChIKey: VJZWEQIULJNRTP-UHFFFAOYSA-N.
| Molecular formula | C8H11N3O3 |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | 1-(3,5-dimethyl-4-nitropyrazol-1-yl)propan-2-one |
| InChIKey | VJZWEQIULJNRTP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CC(=O)C)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)