CAS 954241-13-5 is the registry number for 5,6-Dihydroxy-2-isopropylpyrimidine-4-carboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-hydroxy-6-oxo-2-propan-2-yl-1H-pyrimidine-4-carboxamide (CAS 954241-13-5) is a chemical compound with the molecular formula C8H11N3O3 and a molecular weight of 197.19 g/mol. IUPAC name: 5-hydroxy-6-oxo-2-propan-2-yl-1H-pyrimidine-4-carboxamide. InChIKey: ICTKTQDOANDKDO-UHFFFAOYSA-N.
| Molecular formula | C8H11N3O3 |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | 5-hydroxy-6-oxo-2-propan-2-yl-1H-pyrimidine-4-carboxamide |
| InChIKey | ICTKTQDOANDKDO-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NC(=C(C(=O)N1)O)C(=O)N |
Computed by PubChem (NCBI)