Products 866010-53-9
CAS 866010-53-9 is the registry number for N-(2-Methoxyethyl)-3-nitro-2-pyridinamine, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
N-(2-methoxyethyl)-3-nitropyridin-2-amine (CAS 866010-53-9) is a chemical compound with the molecular formula C8H11N3O3 and a molecular weight of 197.19 g/mol. IUPAC name: N-(2-methoxyethyl)-3-nitropyridin-2-amine. InChIKey: GMNGFFZTDVVXHM-UHFFFAOYSA-N.
| Molecular formula | C8H11N3O3 |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | N-(2-methoxyethyl)-3-nitropyridin-2-amine |
| InChIKey | GMNGFFZTDVVXHM-UHFFFAOYSA-N |
| SMILES | COCCNC1=C(C=CC=N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)