Products 1002651-64-0

CAS 1002651-64-0 is the registry number for 1-((4-tert-Butylphenoxy)methyl)-1H-pyrazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.

Structural formula: {0} (CAS {1})

1-[(4-tert-butylphenoxy)methyl]pyrazole-3-carboxylic acid (CAS 1002651-64-0) is a chemical compound with the molecular formula C15H18N2O3 and a molecular weight of 274.31 g/mol. IUPAC name: 1-[(4-tert-butylphenoxy)methyl]pyrazole-3-carboxylic acid. InChIKey: WLCWGNROJZACTQ-UHFFFAOYSA-N.

Identity
Molecular formulaC15H18N2O3
Molecular weight274.31 g/mol
IUPAC name1-[(4-tert-butylphenoxy)methyl]pyrazole-3-carboxylic acid
InChIKeyWLCWGNROJZACTQ-UHFFFAOYSA-N
SMILESCC(C)(C)C1=CC=C(C=C1)OCN2C=CC(=N2)C(=O)O

Computed by PubChem (NCBI)