CAS 1002754-75-7 appears in our catalog under these names: Boc-L-Photo-Methionine, Boc-L-photo-methionine dCHA, Boc-L-Photo-Methionine*DCHA. Offered by: TRC, Biosynth, Iris Biotech. Available pack sizes: 100mg, 50mg, 250mg, 1g.
(2S)-4-(3-methyldiazirin-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 1002754-75-7) is a chemical compound with the molecular formula C11H19N3O4 and a molecular weight of 257.29 g/mol. IUPAC name: (2S)-4-(3-methyldiazirin-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: PJUUJBXEWCWACQ-ZETCQYMHSA-N.
| Molecular formula | C11H19N3O4 |
|---|---|
| Molecular weight | 257.29 g/mol |
| IUPAC name | (2S)-4-(3-methyldiazirin-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | PJUUJBXEWCWACQ-ZETCQYMHSA-N |
| SMILES | CC1(N=N1)CC[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)