CAS 1171000-90-0 appears in our catalog under these names: 1-(2,2-Diethoxyethyl)-3,5-dimethyl-4-nitro-1H-pyrazole, 97%, 1-(2,2-Diethoxyethyl)-3,5-dimethyl-4-nitro-1H-pyrazole. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
1-(2,2-diethoxyethyl)-3,5-dimethyl-4-nitropyrazole (CAS 1171000-90-0) is a chemical compound with the molecular formula C11H19N3O4 and a molecular weight of 257.29 g/mol. IUPAC name: 1-(2,2-diethoxyethyl)-3,5-dimethyl-4-nitropyrazole. InChIKey: PVGKIAGWLVUVIO-UHFFFAOYSA-N.
| Molecular formula | C11H19N3O4 |
|---|---|
| Molecular weight | 257.29 g/mol |
| IUPAC name | 1-(2,2-diethoxyethyl)-3,5-dimethyl-4-nitropyrazole |
| InChIKey | PVGKIAGWLVUVIO-UHFFFAOYSA-N |
| SMILES | CCOC(CN1C(=C(C(=N1)C)[N+](=O)[O-])C)OCC |
Computed by PubChem (NCBI)