Products 1260683-88-2

CAS 1260683-88-2 is the registry number for N-Methyl-1-(1,3,5-trimethyl-1h-pyrazol-4-yl)ethanamine oxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 5g, 1g.

Structural formula: {0} (CAS {1})

N-methyl-1-(1,3,5-trimethylpyrazol-4-yl)ethanamine;oxalic acid (CAS 1260683-88-2) is a chemical compound with the molecular formula C11H19N3O4 and a molecular weight of 257.29 g/mol. IUPAC name: N-methyl-1-(1,3,5-trimethylpyrazol-4-yl)ethanamine;oxalic acid. InChIKey: LEFWILSCVIIAMO-UHFFFAOYSA-N.

Identity
Molecular formulaC11H19N3O4
Molecular weight257.29 g/mol
IUPAC nameN-methyl-1-(1,3,5-trimethylpyrazol-4-yl)ethanamine;oxalic acid
InChIKeyLEFWILSCVIIAMO-UHFFFAOYSA-N
SMILESCC1=C(C(=NN1C)C)C(C)NC.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)