CAS 1002813-62-8 is the registry number for N-(2,5-Difluorophenyl)-3-methylbenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
N-(2,5-difluorophenyl)-3-methylbenzamide (CAS 1002813-62-8) is a chemical compound with the molecular formula C14H11F2NO and a molecular weight of 247.24 g/mol. IUPAC name: N-(2,5-difluorophenyl)-3-methylbenzamide. InChIKey: CJTYFWZUKHHIIJ-UHFFFAOYSA-N.
| Molecular formula | C14H11F2NO |
|---|---|
| Molecular weight | 247.24 g/mol |
| IUPAC name | N-(2,5-difluorophenyl)-3-methylbenzamide |
| InChIKey | CJTYFWZUKHHIIJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C(=O)NC2=C(C=CC(=C2)F)F |
Computed by PubChem (NCBI)