Products 869631-24-3

CAS 869631-24-3 is the registry number for 2-Acetamino-3,5-difluorobiphenyl, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.

Structural formula: {0} (CAS {1})

N-(2,4-difluoro-6-phenylphenyl)acetamide (CAS 869631-24-3) is a chemical compound with the molecular formula C14H11F2NO and a molecular weight of 247.24 g/mol. IUPAC name: N-(2,4-difluoro-6-phenylphenyl)acetamide. InChIKey: AMMLLLOGNKFMLF-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11F2NO
Molecular weight247.24 g/mol
IUPAC nameN-(2,4-difluoro-6-phenylphenyl)acetamide
InChIKeyAMMLLLOGNKFMLF-UHFFFAOYSA-N
SMILESCC(=O)NC1=C(C=C(C=C1F)F)C2=CC=CC=C2

Computed by PubChem (NCBI)