CAS 869631-24-3 is the registry number for 2-Acetamino-3,5-difluorobiphenyl, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.
N-(2,4-difluoro-6-phenylphenyl)acetamide (CAS 869631-24-3) is a chemical compound with the molecular formula C14H11F2NO and a molecular weight of 247.24 g/mol. IUPAC name: N-(2,4-difluoro-6-phenylphenyl)acetamide. InChIKey: AMMLLLOGNKFMLF-UHFFFAOYSA-N.
| Molecular formula | C14H11F2NO |
|---|---|
| Molecular weight | 247.24 g/mol |
| IUPAC name | N-(2,4-difluoro-6-phenylphenyl)acetamide |
| InChIKey | AMMLLLOGNKFMLF-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=C(C=C1F)F)C2=CC=CC=C2 |
Computed by PubChem (NCBI)