Products 2243410-49-1
CAS 2243410-49-1 is the registry number for N-(Bis(3-fluorophenyl)methyl)formamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.
N-[bis(3-fluorophenyl)methyl]formamide (CAS 2243410-49-1) is a chemical compound with the molecular formula C14H11F2NO and a molecular weight of 247.24 g/mol. IUPAC name: N-[bis(3-fluorophenyl)methyl]formamide. InChIKey: YNNNEBNMJCLLQX-UHFFFAOYSA-N.
| Molecular formula | C14H11F2NO |
|---|---|
| Molecular weight | 247.24 g/mol |
| IUPAC name | N-[bis(3-fluorophenyl)methyl]formamide |
| InChIKey | YNNNEBNMJCLLQX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C(C2=CC(=CC=C2)F)NC=O |
Computed by PubChem (NCBI)