Products 100295-63-4
CAS 100295-63-4 appears in our catalog under these names: Cyproheptadine Impurity 5（Cyproheptadine N-Oxide）, Cyproheptadine N-Oxide, >95% (HPLC), Cyproheptadine N-Oxide, ≥98%, ≥98%. Offered by: Hubei YoungXin, TRC, Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1g, 250mg.
1-methyl-1-oxido-4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidin-1-ium (CAS 100295-63-4) is a chemical compound with the molecular formula C21H21NO and a molecular weight of 303.4 g/mol. IUPAC name: 1-methyl-1-oxido-4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidin-1-ium. InChIKey: AIAORTASLOWFGX-UHFFFAOYSA-N.
| Molecular formula | C21H21NO |
|---|---|
| Molecular weight | 303.4 g/mol |
| IUPAC name | 1-methyl-1-oxido-4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidin-1-ium |
| InChIKey | AIAORTASLOWFGX-UHFFFAOYSA-N |
| SMILES | C[N+]1(CCC(=C2C3=CC=CC=C3C=CC4=CC=CC=C42)CC1)[O-] |
Computed by PubChem (NCBI)