Products 1003042-41-8
CAS 1003042-41-8 appears in our catalog under these names: (2-Amino-5-chlorophenyl)boronic acid, 95+%, 95+%, (2-Amino-5-chlorophenyl)boronic acid, 95+%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(2-amino-5-chlorophenyl)boronic acid (CAS 1003042-41-8) is a chemical compound with the molecular formula C6H7BClNO2 and a molecular weight of 171.39 g/mol. IUPAC name: (2-amino-5-chlorophenyl)boronic acid. InChIKey: NCHRUWKNTBNIBK-UHFFFAOYSA-N.
| Molecular formula | C6H7BClNO2 |
|---|---|
| Molecular weight | 171.39 g/mol |
| IUPAC name | (2-amino-5-chlorophenyl)boronic acid |
| InChIKey | NCHRUWKNTBNIBK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)Cl)N)(O)O |
Computed by PubChem (NCBI)