Products 1003048-71-2
CAS 1003048-71-2 appears in our catalog under these names: 2-Bromo-5-fluorobenzenepropanoic acid, 95%, 2-Bromo-5-fluorobenzenepropanoic acid, 98%, 3-(2-Bromo-5-fluorophenyl)propanoic acid, 95%. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem, Combi-blocks. Available pack sizes: 100mg, 250mg, 1g, 5g.
3-(2-bromo-5-fluorophenyl)propanoic acid (CAS 1003048-71-2) is a chemical compound with the molecular formula C9H8BrFO2 and a molecular weight of 247.06 g/mol. IUPAC name: 3-(2-bromo-5-fluorophenyl)propanoic acid. InChIKey: CBKSPBGBNLIACD-UHFFFAOYSA-N.
| Molecular formula | C9H8BrFO2 |
|---|---|
| Molecular weight | 247.06 g/mol |
| IUPAC name | 3-(2-bromo-5-fluorophenyl)propanoic acid |
| InChIKey | CBKSPBGBNLIACD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)CCC(=O)O)Br |
Computed by PubChem (NCBI)
Synonyms:
3-(2-bromo-5-fluorophenyl)propanoic acid, 2-Bromo-5-fluorobenzenepropanoic acid, Benzenepropanoic acid, 2-bromo-5-fluoro-, 2-Bromo-5-fluorobenzenepropanoicacid, 3-(2-Bromo-5-fluor, 3-(2-bromo-5-fluoro-phenyl)propanoic acid, 3-(2-Bromo-5-fluoro-phenyl)-propionic acid, 3-(2-Bromo-5-fluorophenyl)propionic acid, 2-Bromo-5-fluorohydrocinnamic acid