Products 1003298-72-3
CAS 1003298-72-3 appears in our catalog under these names: 3-Chloro-5-fluoro-4-hydroxyphenylboronic acid, 95%, (3–Chloro–5–fluoro–4–hydroxyphenyl)boronic acid, (3-Chloro-5-fluoro-4-hydroxyphenyl)boronic acid, 97%, 97%, (3-Chloro-5-fluoro-4-hydroxyphenyl)boronic acid, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 10g, 250mg, 100mg, 50mg.
(3-chloro-5-fluoro-4-hydroxyphenyl)boronic acid (CAS 1003298-72-3) is a chemical compound with the molecular formula C6H5BClFO3 and a molecular weight of 190.37 g/mol. IUPAC name: (3-chloro-5-fluoro-4-hydroxyphenyl)boronic acid. InChIKey: WETMDTXTPLMJHT-UHFFFAOYSA-N.
| Molecular formula | C6H5BClFO3 |
|---|---|
| Molecular weight | 190.37 g/mol |
| IUPAC name | (3-chloro-5-fluoro-4-hydroxyphenyl)boronic acid |
| InChIKey | WETMDTXTPLMJHT-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)Cl)O)F)(O)O |
Computed by PubChem (NCBI)