CAS 1003494-10-7 is the registry number for 4-Acetyl-N-(3-(dimethylamino)propyl)benzene-1-sulfonamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-acetyl-N-[3-(dimethylamino)propyl]benzenesulfonamide (CAS 1003494-10-7) is a chemical compound with the molecular formula C13H20N2O3S and a molecular weight of 284.38 g/mol. IUPAC name: 4-acetyl-N-[3-(dimethylamino)propyl]benzenesulfonamide. InChIKey: MZQIJPSRNXMUMZ-UHFFFAOYSA-N.
| Molecular formula | C13H20N2O3S |
|---|---|
| Molecular weight | 284.38 g/mol |
| IUPAC name | 4-acetyl-N-[3-(dimethylamino)propyl]benzenesulfonamide |
| InChIKey | MZQIJPSRNXMUMZ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)S(=O)(=O)NCCCN(C)C |
Computed by PubChem (NCBI)