CAS 34985-57-4 appears in our catalog under these names: 1,4-Diazabicyclo[2.2.2]octane 4-methylbenzenesulfonate, 95%, 1,4–Diazabicyclo(2·2·2)octane 4–methylbenzenesulfonate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 1g, 250mg.
1,4-diazabicyclo[2.2.2]octane;4-methylbenzenesulfonic acid (CAS 34985-57-4) is a chemical compound with the molecular formula C13H20N2O3S and a molecular weight of 284.38 g/mol. IUPAC name: 1,4-diazabicyclo[2.2.2]octane;4-methylbenzenesulfonic acid. InChIKey: FMQZSJVCHOHXQH-UHFFFAOYSA-N.
| Molecular formula | C13H20N2O3S |
|---|---|
| Molecular weight | 284.38 g/mol |
| IUPAC name | 1,4-diazabicyclo[2.2.2]octane;4-methylbenzenesulfonic acid |
| InChIKey | FMQZSJVCHOHXQH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C1CN2CCN1CC2 |
Computed by PubChem (NCBI)