Products 34985-57-4

CAS 34985-57-4 appears in our catalog under these names: 1,4-Diazabicyclo[2.2.2]octane 4-methylbenzenesulfonate, 95%, 1,4–Diazabicyclo(2·2·2)octane 4–methylbenzenesulfonate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

1,4-diazabicyclo[2.2.2]octane;4-methylbenzenesulfonic acid (CAS 34985-57-4) is a chemical compound with the molecular formula C13H20N2O3S and a molecular weight of 284.38 g/mol. IUPAC name: 1,4-diazabicyclo[2.2.2]octane;4-methylbenzenesulfonic acid. InChIKey: FMQZSJVCHOHXQH-UHFFFAOYSA-N.

Identity
Molecular formulaC13H20N2O3S
Molecular weight284.38 g/mol
IUPAC name1,4-diazabicyclo[2.2.2]octane;4-methylbenzenesulfonic acid
InChIKeyFMQZSJVCHOHXQH-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)O.C1CN2CCN1CC2

Computed by PubChem (NCBI)