CAS 329082-04-4 is the registry number for Ethyl 2-amino-5-[(diethylamino)carbonyl]-4-methylthiophene-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
Ethyl 2-amino-5-(diethylcarbamoyl)-4-methylthiophene-3-carboxylate (CAS 329082-04-4) is a chemical compound with the molecular formula C13H20N2O3S and a molecular weight of 284.38 g/mol. IUPAC name: ethyl 2-amino-5-(diethylcarbamoyl)-4-methylthiophene-3-carboxylate. InChIKey: CQFLXLZREFAIKV-UHFFFAOYSA-N.
| Molecular formula | C13H20N2O3S |
|---|---|
| Molecular weight | 284.38 g/mol |
| IUPAC name | ethyl 2-amino-5-(diethylcarbamoyl)-4-methylthiophene-3-carboxylate |
| InChIKey | CQFLXLZREFAIKV-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=C(C(=C(S1)N)C(=O)OCC)C |
Computed by PubChem (NCBI)