CAS 1003589-87-4 is the registry number for 2-[3-(Chloromethyl)-6-methoxypyridin-2-yl]ethyl methanesulfonate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
2-[3-(chloromethyl)-6-methoxy-2-pyridinyl]ethyl methanesulfonate (CAS 1003589-87-4) is a chemical compound with the molecular formula C10H14ClNO4S and a molecular weight of 279.74 g/mol. IUPAC name: 2-[3-(chloromethyl)-6-methoxy-2-pyridinyl]ethyl methanesulfonate. InChIKey: LDOLCEWPSKHBLP-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO4S |
|---|---|
| Molecular weight | 279.74 g/mol |
| IUPAC name | 2-[3-(chloromethyl)-6-methoxy-2-pyridinyl]ethyl methanesulfonate |
| InChIKey | LDOLCEWPSKHBLP-UHFFFAOYSA-N |
| SMILES | COC1=NC(=C(C=C1)CCl)CCOS(=O)(=O)C |
Computed by PubChem (NCBI)