Products 1003589-87-4

CAS 1003589-87-4 is the registry number for 2-[3-(Chloromethyl)-6-methoxypyridin-2-yl]ethyl methanesulfonate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

2-[3-(chloromethyl)-6-methoxy-2-pyridinyl]ethyl methanesulfonate (CAS 1003589-87-4) is a chemical compound with the molecular formula C10H14ClNO4S and a molecular weight of 279.74 g/mol. IUPAC name: 2-[3-(chloromethyl)-6-methoxy-2-pyridinyl]ethyl methanesulfonate. InChIKey: LDOLCEWPSKHBLP-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14ClNO4S
Molecular weight279.74 g/mol
IUPAC name2-[3-(chloromethyl)-6-methoxy-2-pyridinyl]ethyl methanesulfonate
InChIKeyLDOLCEWPSKHBLP-UHFFFAOYSA-N
SMILESCOC1=NC(=C(C=C1)CCl)CCOS(=O)(=O)C

Computed by PubChem (NCBI)