CAS 2177264-60-5 appears in our catalog under these names: (S)–2–Amino–3–(3–(methylsulfonyl)phenyl)propanoic acid hydrochloride, (S)-2-Amino-3-(3-(methylsulfonyl)phenyl)propanoic acid hydrochloride, 98%, 98%, (S)-2-Amino-3-(3-(methylsulfonyl)phenyl)propanoic acid hydrochloride, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100g.
(2S)-2-amino-3-(3-methylsulfonylphenyl)propanoic acid;hydrochloride (CAS 2177264-60-5) is a chemical compound with the molecular formula C10H14ClNO4S and a molecular weight of 279.74 g/mol. IUPAC name: (2S)-2-amino-3-(3-methylsulfonylphenyl)propanoic acid;hydrochloride. InChIKey: SODPTEIBYBFURE-FVGYRXGTSA-N.
| Molecular formula | C10H14ClNO4S |
|---|---|
| Molecular weight | 279.74 g/mol |
| IUPAC name | (2S)-2-amino-3-(3-methylsulfonylphenyl)propanoic acid;hydrochloride |
| InChIKey | SODPTEIBYBFURE-FVGYRXGTSA-N |
| SMILES | CS(=O)(=O)C1=CC=CC(=C1)C[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)