CAS 2049127-86-6 appears in our catalog under these names: Lifitegrast Impurity 39 HCl, 3-(Methylsulfonyl)-D-phenylalanine Hydrochloride. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
(2R)-2-amino-3-(3-methylsulfonylphenyl)propanoic acid;hydrochloride (CAS 2049127-86-6) is a chemical compound with the molecular formula C10H14ClNO4S and a molecular weight of 279.74 g/mol. IUPAC name: (2R)-2-amino-3-(3-methylsulfonylphenyl)propanoic acid;hydrochloride. InChIKey: SODPTEIBYBFURE-SBSPUUFOSA-N.
| Molecular formula | C10H14ClNO4S |
|---|---|
| Molecular weight | 279.74 g/mol |
| IUPAC name | (2R)-2-amino-3-(3-methylsulfonylphenyl)propanoic acid;hydrochloride |
| InChIKey | SODPTEIBYBFURE-SBSPUUFOSA-N |
| SMILES | CS(=O)(=O)C1=CC=CC(=C1)C[C@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)