CAS 1003872-58-9 appears in our catalog under these names: (1R,3S,4R)–Methyl 4–aminoadamantane–1–carboxylate hydrochloride, (1R,3S,4R)-Methyl 4-aminoadamantane-1-carboxylate hydrochloride, 98%, 98%, Methyl (3R,5S)-4-aminoadamantane-1-carboxylate hydrochloride. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
Methyl (3S)-4-aminoadamantane-1-carboxylate;hydrochloride (CAS 1003872-58-9) is a chemical compound with the molecular formula C12H20ClNO2 and a molecular weight of 245.74 g/mol. IUPAC name: methyl (3S)-4-aminoadamantane-1-carboxylate;hydrochloride. InChIKey: MANHEPNXZVTZLG-DXFGONOJSA-N.
| Molecular formula | C12H20ClNO2 |
|---|---|
| Molecular weight | 245.74 g/mol |
| IUPAC name | methyl (3S)-4-aminoadamantane-1-carboxylate;hydrochloride |
| InChIKey | MANHEPNXZVTZLG-DXFGONOJSA-N |
| SMILES | COC(=O)C12C[C@@H]3CC(C1)CC(C2)C3N.Cl |
Computed by PubChem (NCBI)