Products 100393-43-9
CAS 100393-43-9 appears in our catalog under these names: Doxylamine Impurity 1, alpha-methyl-alpha-phenyl-2-pyridinemethanol 1-Oxide, (1RS)-1-Phenyl-1-(pyridin-2-yl)ethanol N-Oxide. Offered by: Chemat Brand, TRC, Mikromol, Biosynth. Available pack sizes: on request, 1g, 25mg, 500mg.
1-(1-oxidopyridin-1-ium-2-yl)-1-phenylethanol (CAS 100393-43-9) is a chemical compound with the molecular formula C13H13NO2 and a molecular weight of 215.25 g/mol. IUPAC name: 1-(1-oxidopyridin-1-ium-2-yl)-1-phenylethanol. InChIKey: PNDSFSTXHFPKNJ-UHFFFAOYSA-N.
| Molecular formula | C13H13NO2 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | 1-(1-oxidopyridin-1-ium-2-yl)-1-phenylethanol |
| InChIKey | PNDSFSTXHFPKNJ-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1)(C2=CC=CC=[N+]2[O-])O |
Computed by PubChem (NCBI)