Products 1004193-08-1

CAS 1004193-08-1 is the registry number for 1-(3-Chloro-4-fluorophenoxymethyl)-1h-pyrazole-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

1-[(3-chloro-4-fluorophenoxy)methyl]pyrazole-3-carboxylic acid (CAS 1004193-08-1) is a chemical compound with the molecular formula C11H8ClFN2O3 and a molecular weight of 270.64 g/mol. IUPAC name: 1-[(3-chloro-4-fluorophenoxy)methyl]pyrazole-3-carboxylic acid. InChIKey: JXBKDZQBVWHPQT-UHFFFAOYSA-N.

Identity
Molecular formulaC11H8ClFN2O3
Molecular weight270.64 g/mol
IUPAC name1-[(3-chloro-4-fluorophenoxy)methyl]pyrazole-3-carboxylic acid
InChIKeyJXBKDZQBVWHPQT-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1OCN2C=CC(=N2)C(=O)O)Cl)F

Computed by PubChem (NCBI)