CAS 79286-73-0 is the registry number for Enoxacin Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
7-chloro-1-ethyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid (CAS 79286-73-0) is a chemical compound with the molecular formula C11H8ClFN2O3 and a molecular weight of 270.64 g/mol. IUPAC name: 7-chloro-1-ethyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid. InChIKey: LJYJAEQCLXAHFQ-UHFFFAOYSA-N.
| Molecular formula | C11H8ClFN2O3 |
|---|---|
| Molecular weight | 270.64 g/mol |
| IUPAC name | 7-chloro-1-ethyl-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid |
| InChIKey | LJYJAEQCLXAHFQ-UHFFFAOYSA-N |
| SMILES | CCN1C=C(C(=O)C2=CC(=C(N=C21)Cl)F)C(=O)O |
Computed by PubChem (NCBI)