CAS 1384079-99-5 is the registry number for Ethyl 3-(3-chloro-4-fluorophenyl)-1,2,4-oxadiazole-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 3-(3-chloro-4-fluorophenyl)-1,2,4-oxadiazole-5-carboxylate (CAS 1384079-99-5) is a chemical compound with the molecular formula C11H8ClFN2O3 and a molecular weight of 270.64 g/mol. IUPAC name: ethyl 3-(3-chloro-4-fluorophenyl)-1,2,4-oxadiazole-5-carboxylate. InChIKey: IMBGNBPGXWWUQF-UHFFFAOYSA-N.
| Molecular formula | C11H8ClFN2O3 |
|---|---|
| Molecular weight | 270.64 g/mol |
| IUPAC name | ethyl 3-(3-chloro-4-fluorophenyl)-1,2,4-oxadiazole-5-carboxylate |
| InChIKey | IMBGNBPGXWWUQF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=NO1)C2=CC(=C(C=C2)F)Cl |
Computed by PubChem (NCBI)