CAS 1004194-36-8 is the registry number for 1-((4-Bromo-3,5-dimethyl-1H-pyrazol-1-yl)methyl)-1H-pyrazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]pyrazole-3-carboxylic acid (CAS 1004194-36-8) is a chemical compound with the molecular formula C10H11BrN4O2 and a molecular weight of 299.12 g/mol. IUPAC name: 1-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]pyrazole-3-carboxylic acid. InChIKey: UINUDSMQMZQFSZ-UHFFFAOYSA-N.
| Molecular formula | C10H11BrN4O2 |
|---|---|
| Molecular weight | 299.12 g/mol |
| IUPAC name | 1-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]pyrazole-3-carboxylic acid |
| InChIKey | UINUDSMQMZQFSZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CN2C=CC(=N2)C(=O)O)C)Br |
Computed by PubChem (NCBI)