CAS 1006464-57-8 is the registry number for 2-(4-Bromo-3-(1,5-dimethyl-1H-pyrazol-4-yl)-1H-pyrazol-1-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[4-bromo-3-(1,5-dimethylpyrazol-4-yl)pyrazol-1-yl]acetic acid (CAS 1006464-57-8) is a chemical compound with the molecular formula C10H11BrN4O2 and a molecular weight of 299.12 g/mol. IUPAC name: 2-[4-bromo-3-(1,5-dimethylpyrazol-4-yl)pyrazol-1-yl]acetic acid. InChIKey: RLPXWPKDULQGIY-UHFFFAOYSA-N.
| Molecular formula | C10H11BrN4O2 |
|---|---|
| Molecular weight | 299.12 g/mol |
| IUPAC name | 2-[4-bromo-3-(1,5-dimethylpyrazol-4-yl)pyrazol-1-yl]acetic acid |
| InChIKey | RLPXWPKDULQGIY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NN1C)C2=NN(C=C2Br)CC(=O)O |
Computed by PubChem (NCBI)