CAS 1803611-05-3 is the registry number for 5-Bromo-1-((3-ethyl-1,2,4-oxadiazol-5-yl)methyl)-2-methyl-1,4-dihydropyrimidin-4-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-bromo-1-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]-2-methylpyrimidin-4-one (CAS 1803611-05-3) is a chemical compound with the molecular formula C10H11BrN4O2 and a molecular weight of 299.12 g/mol. IUPAC name: 5-bromo-1-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]-2-methylpyrimidin-4-one. InChIKey: JQNNAGMYOIGBKW-UHFFFAOYSA-N.
| Molecular formula | C10H11BrN4O2 |
|---|---|
| Molecular weight | 299.12 g/mol |
| IUPAC name | 5-bromo-1-[(3-ethyl-1,2,4-oxadiazol-5-yl)methyl]-2-methylpyrimidin-4-one |
| InChIKey | JQNNAGMYOIGBKW-UHFFFAOYSA-N |
| SMILES | CCC1=NOC(=N1)CN2C=C(C(=O)N=C2C)Br |
Computed by PubChem (NCBI)