Products 1004305-95-6
CAS 1004305-95-6 is the registry number for ethyl 2-([1,1'-biphenyl]-3-yl)-2-oxoacetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
Ethyl 2-oxo-2-(3-phenylphenyl)acetate (CAS 1004305-95-6) is a chemical compound with the molecular formula C16H14O3 and a molecular weight of 254.28 g/mol. IUPAC name: ethyl 2-oxo-2-(3-phenylphenyl)acetate. InChIKey: XSCFGRSGFSQSEX-UHFFFAOYSA-N.
| Molecular formula | C16H14O3 |
|---|---|
| Molecular weight | 254.28 g/mol |
| IUPAC name | ethyl 2-oxo-2-(3-phenylphenyl)acetate |
| InChIKey | XSCFGRSGFSQSEX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)C1=CC=CC(=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)