Products 1004315-82-5
CAS 1004315-82-5 is the registry number for 3’-o-Benzyl-(1R)-hydroxy tapentadol. Offered by: Biosynth. Available pack sizes: 50mg, 25mg, 100mg.
(2S,3R)-1-(dimethylamino)-2-methyl-3-(3-phenylmethoxyphenyl)pentan-3-ol (CAS 1004315-82-5) is a chemical compound with the molecular formula C21H29NO2 and a molecular weight of 327.5 g/mol. IUPAC name: (2S,3R)-1-(dimethylamino)-2-methyl-3-(3-phenylmethoxyphenyl)pentan-3-ol. InChIKey: BYTDRZBEHCAVQA-LAUBAEHRSA-N.
| Molecular formula | C21H29NO2 |
|---|---|
| Molecular weight | 327.5 g/mol |
| IUPAC name | (2S,3R)-1-(dimethylamino)-2-methyl-3-(3-phenylmethoxyphenyl)pentan-3-ol |
| InChIKey | BYTDRZBEHCAVQA-LAUBAEHRSA-N |
| SMILES | CC[C@](C1=CC(=CC=C1)OCC2=CC=CC=C2)([C@@H](C)CN(C)C)O |
Computed by PubChem (NCBI)