CAS 1004643-36-0 is the registry number for 1-(Biphenyl-4-yloxymethyl)-1H-pyrazole-3-carboxylic acid hydrazide. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
1-[(4-phenylphenoxy)methyl]pyrazole-3-carbohydrazide (CAS 1004643-36-0) is a chemical compound with the molecular formula C17H16N4O2 and a molecular weight of 308.33 g/mol. IUPAC name: 1-[(4-phenylphenoxy)methyl]pyrazole-3-carbohydrazide. InChIKey: WOGZFVXKPGDUBC-UHFFFAOYSA-N.
| Molecular formula | C17H16N4O2 |
|---|---|
| Molecular weight | 308.33 g/mol |
| IUPAC name | 1-[(4-phenylphenoxy)methyl]pyrazole-3-carbohydrazide |
| InChIKey | WOGZFVXKPGDUBC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)OCN3C=CC(=N3)C(=O)NN |
Computed by PubChem (NCBI)