Products 432507-62-5
CAS 432507-62-5 appears in our catalog under these names: Fmoc-eda-n3, 98%, Fmoc-EDA-N3. Offered by: Combi-blocks, Iris Biotech, MedChemExpress. Available pack sizes: 250mg, 5g, 1g, 25g, Get quote.
9H-fluoren-9-ylmethyl N-(2-azidoethyl)carbamate (CAS 432507-62-5) is a chemical compound with the molecular formula C17H16N4O2 and a molecular weight of 308.33 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-(2-azidoethyl)carbamate. InChIKey: HIOHZKBHUFSLNY-UHFFFAOYSA-N.
| Molecular formula | C17H16N4O2 |
|---|---|
| Molecular weight | 308.33 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-(2-azidoethyl)carbamate |
| InChIKey | HIOHZKBHUFSLNY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCN=[N+]=[N-] |
Computed by PubChem (NCBI)