Products 835876-19-2

CAS 835876-19-2 is the registry number for 6,6''-Dimethoxy-(3,3',5',3'')terpyridin-2'-ylamine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 250mg, 500mg, 1g, 2,5g, 5g, 10g.

Structural formula: {0} (CAS {1})

3,5-bis(6-methoxy-3-pyridinyl)pyridin-2-amine (CAS 835876-19-2) is a chemical compound with the molecular formula C17H16N4O2 and a molecular weight of 308.33 g/mol. IUPAC name: 3,5-bis(6-methoxy-3-pyridinyl)pyridin-2-amine. InChIKey: ADECQYTURGAKRL-UHFFFAOYSA-N.

Identity
Molecular formulaC17H16N4O2
Molecular weight308.33 g/mol
IUPAC name3,5-bis(6-methoxy-3-pyridinyl)pyridin-2-amine
InChIKeyADECQYTURGAKRL-UHFFFAOYSA-N
SMILESCOC1=NC=C(C=C1)C2=CC(=C(N=C2)N)C3=CN=C(C=C3)OC

Computed by PubChem (NCBI)