Products 1004644-64-7

CAS 1004644-64-7 is the registry number for 3-(4-Chloro-3-nitro-1H-pyrazol-1-yl)propanoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

3-(4-chloro-3-nitropyrazol-1-yl)propanoic acid (CAS 1004644-64-7) is a chemical compound with the molecular formula C6H6ClN3O4 and a molecular weight of 219.58 g/mol. IUPAC name: 3-(4-chloro-3-nitropyrazol-1-yl)propanoic acid. InChIKey: FSXPGXHGUGQSMX-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6ClN3O4
Molecular weight219.58 g/mol
IUPAC name3-(4-chloro-3-nitropyrazol-1-yl)propanoic acid
InChIKeyFSXPGXHGUGQSMX-UHFFFAOYSA-N
SMILESC1=C(C(=NN1CCC(=O)O)[N+](=O)[O-])Cl

Computed by PubChem (NCBI)