CAS 1004644-64-7 is the registry number for 3-(4-Chloro-3-nitro-1H-pyrazol-1-yl)propanoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-(4-chloro-3-nitropyrazol-1-yl)propanoic acid (CAS 1004644-64-7) is a chemical compound with the molecular formula C6H6ClN3O4 and a molecular weight of 219.58 g/mol. IUPAC name: 3-(4-chloro-3-nitropyrazol-1-yl)propanoic acid. InChIKey: FSXPGXHGUGQSMX-UHFFFAOYSA-N.
| Molecular formula | C6H6ClN3O4 |
|---|---|
| Molecular weight | 219.58 g/mol |
| IUPAC name | 3-(4-chloro-3-nitropyrazol-1-yl)propanoic acid |
| InChIKey | FSXPGXHGUGQSMX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NN1CCC(=O)O)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)