CAS 1203-25-4 appears in our catalog under these names: 6-Chloro-1,3-dimethyl-5-nitro-1,2,3,4-tetrahydropyrimidine-2,4-dione, 95-<97%, 6-Chloro-1,3-dimethyl-5-nitrouracil. Offered by: Hoffman Fine Chemicals, TRC. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.
6-chloro-1,3-dimethyl-5-nitropyrimidine-2,4-dione (CAS 1203-25-4) is a chemical compound with the molecular formula C6H6ClN3O4 and a molecular weight of 219.58 g/mol. IUPAC name: 6-chloro-1,3-dimethyl-5-nitropyrimidine-2,4-dione. InChIKey: ZOPMTVMJANWXKJ-UHFFFAOYSA-N.
| Molecular formula | C6H6ClN3O4 |
|---|---|
| Molecular weight | 219.58 g/mol |
| IUPAC name | 6-chloro-1,3-dimethyl-5-nitropyrimidine-2,4-dione |
| InChIKey | ZOPMTVMJANWXKJ-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C(=O)N(C1=O)C)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)