CAS 60331-03-5 is the registry number for 4-Chloro-2,6-dimethoxy-5-nitropyrimidine. Offered by: TRC. Available pack sizes: 1g, 500mg, 5g.
4-chloro-2,6-dimethoxy-5-nitropyrimidine (CAS 60331-03-5) is a chemical compound with the molecular formula C6H6ClN3O4 and a molecular weight of 219.58 g/mol. IUPAC name: 4-chloro-2,6-dimethoxy-5-nitropyrimidine. InChIKey: DZVJFWKOQFZUII-UHFFFAOYSA-N.
| Molecular formula | C6H6ClN3O4 |
|---|---|
| Molecular weight | 219.58 g/mol |
| IUPAC name | 4-chloro-2,6-dimethoxy-5-nitropyrimidine |
| InChIKey | DZVJFWKOQFZUII-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=NC(=N1)OC)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)