Products 1004759-89-0
CAS 1004759-89-0 is the registry number for (S)-2-(Boc-amino)-2-(o-tolyl)acetic Acid, >97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
(2S)-2-(2-methylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 1004759-89-0) is a chemical compound with the molecular formula C14H19NO4 and a molecular weight of 265.30 g/mol. IUPAC name: (2S)-2-(2-methylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: OGMPKTUPLFYBGH-NSHDSACASA-N.
| Molecular formula | C14H19NO4 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | (2S)-2-(2-methylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | OGMPKTUPLFYBGH-NSHDSACASA-N |
| SMILES | CC1=CC=CC=C1[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)