CAS 1005090-06-1 appears in our catalog under these names: 4-Amino-N-(1-{bicyclo(2.2.1)heptan-2-yl}ethyl)benzene-1-sulfonamide, 4-Amino-N-(1-{bicyclo(2.2.1)heptan-2-yl}ethyl)benzene-1-sulfonamide, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 5g.
4-amino-N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]benzenesulfonamide (CAS 1005090-06-1) is a chemical compound with the molecular formula C15H22N2O2S and a molecular weight of 294.4 g/mol. IUPAC name: 4-amino-N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]benzenesulfonamide. InChIKey: ZGICLUUQRQJGQH-UHFFFAOYSA-N.
| Molecular formula | C15H22N2O2S |
|---|---|
| Molecular weight | 294.4 g/mol |
| IUPAC name | 4-amino-N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]benzenesulfonamide |
| InChIKey | ZGICLUUQRQJGQH-UHFFFAOYSA-N |
| SMILES | CC(C1CC2CCC1C2)NS(=O)(=O)C3=CC=C(C=C3)N |
Computed by PubChem (NCBI)