Products 100511-00-0
CAS 100511-00-0 appears in our catalog under these names: 3，3–DiMethyl–5–nitroindolin–2–one, 3,3-Dimethyl-5-nitroindolin-2-one, 95%, 95%, 3,3-Dimethyl-5-nitroindolin-2-one, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
3,3-dimethyl-5-nitro-1H-indol-2-one (CAS 100511-00-0) is a chemical compound with the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. IUPAC name: 3,3-dimethyl-5-nitro-1H-indol-2-one. InChIKey: UMHSOWVJQJFESZ-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O3 |
|---|---|
| Molecular weight | 206.20 g/mol |
| IUPAC name | 3,3-dimethyl-5-nitro-1H-indol-2-one |
| InChIKey | UMHSOWVJQJFESZ-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=CC(=C2)[N+](=O)[O-])NC1=O)C |
Computed by PubChem (NCBI)