CAS 100516-88-9 appears in our catalog under these names: 6-Quinolinylmethanol, 97% , Quinolin-6-ylmethanol 97%, Quinolin-6-ylmethanol, 97%, 97%, 6-quinolinemethanol, 95%. Offered by: Thermo Scientific, Ambeed, Chemat, Fluorochem. Available pack sizes: 250MG, 1g, 5g, 25g.
Quinolin-6-ylmethanol (CAS 100516-88-9) is a chemical compound with the molecular formula C10H9NO and a molecular weight of 159.18 g/mol. IUPAC name: quinolin-6-ylmethanol. InChIKey: YQEJIIUSNDZIGO-UHFFFAOYSA-N.
| Molecular formula | C10H9NO |
|---|---|
| Molecular weight | 159.18 g/mol |
| IUPAC name | quinolin-6-ylmethanol |
| InChIKey | YQEJIIUSNDZIGO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)CO)N=C1 |
Computed by PubChem (NCBI)