CAS 100527-13-7 is the registry number for 2-(Benzo[d]thiazol-2-yl)benzo[d]isothiazol-3(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(1,3-benzothiazol-2-yl)-1,2-benzothiazol-3-one (CAS 100527-13-7) is a chemical compound with the molecular formula C14H8N2OS2 and a molecular weight of 284.4 g/mol. IUPAC name: 2-(1,3-benzothiazol-2-yl)-1,2-benzothiazol-3-one. InChIKey: AFZGIXXHGWBHHD-UHFFFAOYSA-N.
| Molecular formula | C14H8N2OS2 |
|---|---|
| Molecular weight | 284.4 g/mol |
| IUPAC name | 2-(1,3-benzothiazol-2-yl)-1,2-benzothiazol-3-one |
| InChIKey | AFZGIXXHGWBHHD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(S2)C3=NC4=CC=CC=C4S3 |
Computed by PubChem (NCBI)