CAS 2248255-24-3 is the registry number for 2-(Thiophen-2-yl)-4H-benzo[4,5]imidazo[2,1-b][1,3]thiazin-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-thiophen-2-yl-[1,3]thiazino[3,2-a]benzimidazol-4-one (CAS 2248255-24-3) is a chemical compound with the molecular formula C14H8N2OS2 and a molecular weight of 284.4 g/mol. IUPAC name: 2-thiophen-2-yl-[1,3]thiazino[3,2-a]benzimidazol-4-one. InChIKey: DDIBJWKWOIILQY-UHFFFAOYSA-N.
| Molecular formula | C14H8N2OS2 |
|---|---|
| Molecular weight | 284.4 g/mol |
| IUPAC name | 2-thiophen-2-yl-[1,3]thiazino[3,2-a]benzimidazol-4-one |
| InChIKey | DDIBJWKWOIILQY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C3N2C(=O)C=C(S3)C4=CC=CS4 |
Computed by PubChem (NCBI)