Products 10396-05-1
CAS 10396-05-1 appears in our catalog under these names: 4-Isothiocyanatophenyl ether, 95%, 4,4'-Oxybis(isothiocyanatobenzene), 95%. Offered by: Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 100mg, 250mg.
1-isothiocyanato-4-(4-isothiocyanatophenoxy)benzene (CAS 10396-05-1) is a chemical compound with the molecular formula C14H8N2OS2 and a molecular weight of 284.4 g/mol. IUPAC name: 1-isothiocyanato-4-(4-isothiocyanatophenoxy)benzene. InChIKey: VFRHGFVMLLSTNS-UHFFFAOYSA-N.
| Molecular formula | C14H8N2OS2 |
|---|---|
| Molecular weight | 284.4 g/mol |
| IUPAC name | 1-isothiocyanato-4-(4-isothiocyanatophenoxy)benzene |
| InChIKey | VFRHGFVMLLSTNS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N=C=S)OC2=CC=C(C=C2)N=C=S |
Computed by PubChem (NCBI)