Products 1005397-62-5

CAS 1005397-62-5 appears in our catalog under these names: 2,6-Dimethylpiperidin-4-one hydrochloride, 95%, 2,6-Dimethylpiperidin-4-one hydrochloride, 97%, 2,6-Dimethylpiperidin-4-one hydrochloride, 2,6-Dimethylpiperidin-4-one hydrochloride, 97%, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 50mg, 500mg.

Structural formula: {0} (CAS {1})

2,6-dimethylpiperidin-4-one;hydrochloride (CAS 1005397-62-5) is a chemical compound with the molecular formula C7H14ClNO and a molecular weight of 163.64 g/mol. IUPAC name: 2,6-dimethylpiperidin-4-one;hydrochloride. InChIKey: NGNMAFCFQYPWAU-UHFFFAOYSA-N.

Identity
Molecular formulaC7H14ClNO
Molecular weight163.64 g/mol
IUPAC name2,6-dimethylpiperidin-4-one;hydrochloride
InChIKeyNGNMAFCFQYPWAU-UHFFFAOYSA-N
SMILESCC1CC(=O)CC(N1)C.Cl

Computed by PubChem (NCBI)