CAS 879007-42-8 appears in our catalog under these names: Cis-2,6-dimethylpiperidin-4-one hydrochloride, 97%, cis-2,6-dimethylpiperidin-4-one hydrochloride, 97%, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 250mg, 500mg, 100mg.
(2R,6S)-2,6-dimethylpiperidin-4-one;hydrochloride (CAS 879007-42-8) is a chemical compound with the molecular formula C7H14ClNO and a molecular weight of 163.64 g/mol. IUPAC name: (2R,6S)-2,6-dimethylpiperidin-4-one;hydrochloride. InChIKey: NGNMAFCFQYPWAU-KNCHESJLSA-N.
| Molecular formula | C7H14ClNO |
|---|---|
| Molecular weight | 163.64 g/mol |
| IUPAC name | (2R,6S)-2,6-dimethylpiperidin-4-one;hydrochloride |
| InChIKey | NGNMAFCFQYPWAU-KNCHESJLSA-N |
| SMILES | C[C@@H]1CC(=O)C[C@@H](N1)C.Cl |
Computed by PubChem (NCBI)