CAS 1311160-86-7 appears in our catalog under these names: Trans-2,6-dimethyl-4-oxo-piperidine hydrochloride, rac-(2R,6R)-2,6-dimethylpiperidin-4-one hydrochloride, 95%, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 0,5g, 50mg, 1g.
(2R,6R)-2,6-dimethylpiperidin-4-one;hydrochloride (CAS 1311160-86-7) is a chemical compound with the molecular formula C7H14ClNO and a molecular weight of 163.64 g/mol. IUPAC name: (2R,6R)-2,6-dimethylpiperidin-4-one;hydrochloride. InChIKey: NGNMAFCFQYPWAU-KGZKBUQUSA-N.
| Molecular formula | C7H14ClNO |
|---|---|
| Molecular weight | 163.64 g/mol |
| IUPAC name | (2R,6R)-2,6-dimethylpiperidin-4-one;hydrochloride |
| InChIKey | NGNMAFCFQYPWAU-KGZKBUQUSA-N |
| SMILES | C[C@@H]1CC(=O)C[C@H](N1)C.Cl |
Computed by PubChem (NCBI)