CAS 1005489-34-8 is the registry number for 5-(1-(Methylthio)ethyl)-2-trifluoromethylpyridine, >95% (HPLC). Offered by: TRC. Available pack sizes: 250mg, 500mg, 50mg.
5-(1-methylsulfanylethyl)-2-(trifluoromethyl)pyridine (CAS 1005489-34-8) is a chemical compound with the molecular formula C9H10F3NS and a molecular weight of 221.24 g/mol. IUPAC name: 5-(1-methylsulfanylethyl)-2-(trifluoromethyl)pyridine. InChIKey: NGPCQVZAFDWNQL-UHFFFAOYSA-N.
| Molecular formula | C9H10F3NS |
|---|---|
| Molecular weight | 221.24 g/mol |
| IUPAC name | 5-(1-methylsulfanylethyl)-2-(trifluoromethyl)pyridine |
| InChIKey | NGPCQVZAFDWNQL-UHFFFAOYSA-N |
| SMILES | CC(C1=CN=C(C=C1)C(F)(F)F)SC |
Computed by PubChem (NCBI)