CAS 2677-71-6 is the registry number for N,N-Dimethyl-4-((trifluoromethyl)thio)benzenamine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g.
N,N-dimethyl-4-(trifluoromethylsulfanyl)aniline (CAS 2677-71-6) is a chemical compound with the molecular formula C9H10F3NS and a molecular weight of 221.24 g/mol. IUPAC name: N,N-dimethyl-4-(trifluoromethylsulfanyl)aniline. InChIKey: MDGKYHTVVJPJEP-UHFFFAOYSA-N.
| Molecular formula | C9H10F3NS |
|---|---|
| Molecular weight | 221.24 g/mol |
| IUPAC name | N,N-dimethyl-4-(trifluoromethylsulfanyl)aniline |
| InChIKey | MDGKYHTVVJPJEP-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)SC(F)(F)F |
Computed by PubChem (NCBI)